Update README.md
Browse files
README.md
CHANGED
|
@@ -59,6 +59,8 @@ task_ids: []
|
|
| 59 |
|
| 60 |
`clintox` is a dataset included in [MoleculeNet](https://moleculenet.org/). Qualitative data of drugs approved by the FDA and those that have failed clinical trials for toxicity reasons. This uses the `CT_TOX` task.
|
| 61 |
|
|
|
|
|
|
|
| 62 |
## Dataset Structure
|
| 63 |
|
| 64 |
### Data Fields
|
|
|
|
| 59 |
|
| 60 |
`clintox` is a dataset included in [MoleculeNet](https://moleculenet.org/). Qualitative data of drugs approved by the FDA and those that have failed clinical trials for toxicity reasons. This uses the `CT_TOX` task.
|
| 61 |
|
| 62 |
+
Note, there was one molecule in the training set that could not be converted to SELFIES (`*C(=O)[C@H](CCCCNC(=O)OCCOC)NC(=O)OCCOC`)
|
| 63 |
+
|
| 64 |
## Dataset Structure
|
| 65 |
|
| 66 |
### Data Fields
|